C16H25NO3S — CID 104522717
3-amino-2-(3,4-dimethylphenyl)-1-(1,1-dioxothian-2-yl)propan-1-ol (PubChem CID 104522717) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is 3-amino-2-(3,4-dimethylphenyl)-1-(1,1-dioxothian-2-yl)propan-1-ol.
| Compound Name | 3-amino-2-(3,4-dimethylphenyl)-1-(1,1-dioxothian-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 104522717 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 3-amino-2-(3,4-dimethylphenyl)-1-(1,1-dioxothian-2-yl)propan-1-ol |
| SMILES | Cc1ccc(C(CN)C(O)C2CCCCS2(=O)=O)cc1C |
| InChI | InChI=1S/C16H25NO3S/c1-11-6-7-13(9-12(11)2)14(10-17)16(18)15-5-3-4-8-21(15,19)20/h6-7,9,14-16,18H,3-5,8,10,17H2,1-2H3 |
| InChIKey | LGGLNWGWIHGQSU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |