C19H31NO — CID 114459281
4-amino-1-cycloheptyl-3-(3,4-dimethylphenyl)butan-2-ol (PubChem CID 114459281) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is 4-amino-1-cycloheptyl-3-(3,4-dimethylphenyl)butan-2-ol.
| Compound Name | 4-amino-1-cycloheptyl-3-(3,4-dimethylphenyl)butan-2-ol |
|---|---|
| PubChem CID | 114459281 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | 4-amino-1-cycloheptyl-3-(3,4-dimethylphenyl)butan-2-ol |
| SMILES | Cc1ccc(C(CN)C(O)CC2CCCCCC2)cc1C |
| InChI | InChI=1S/C19H31NO/c1-14-9-10-17(11-15(14)2)18(13-20)19(21)12-16-7-5-3-4-6-8-16/h9-11,16,18-19,21H,3-8,12-13,20H2,1-2H3 |
| InChIKey | UOHNUDKHMQKVGH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |