C14H19FO3S — CID 115838262
1-(1,1-dioxothian-2-yl)-2-(4-fluoro-2-methylphenyl)ethanol (PubChem CID 115838262) has the molecular formula C14H19FO3S and a molecular weight of 286.37 g/mol. Its IUPAC name is 1-(1,1-dioxothian-2-yl)-2-(4-fluoro-2-methylphenyl)ethanol.
| Compound Name | 1-(1,1-dioxothian-2-yl)-2-(4-fluoro-2-methylphenyl)ethanol |
|---|---|
| PubChem CID | 115838262 |
| Molecular Formula | C14H19FO3S |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1-(1,1-dioxothian-2-yl)-2-(4-fluoro-2-methylphenyl)ethanol |
| SMILES | Cc1cc(F)ccc1CC(O)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C14H19FO3S/c1-10-8-12(15)6-5-11(10)9-13(16)14-4-2-3-7-19(14,17)18/h5-6,8,13-14,16H,2-4,7,9H2,1H3 |
| InChIKey | ZXKMUMDDMRXNIQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |