C13H17BrFNO2S — CID 115843641
2-(2-bromo-5-fluorophenyl)-1-(1,1-dioxothian-2-yl)ethanamine (PubChem CID 115843641) has the molecular formula C13H17BrFNO2S and a molecular weight of 350.25 g/mol. Its IUPAC name is 2-(2-bromo-5-fluorophenyl)-1-(1,1-dioxothian-2-yl)ethanamine.
| Compound Name | 2-(2-bromo-5-fluorophenyl)-1-(1,1-dioxothian-2-yl)ethanamine |
|---|---|
| PubChem CID | 115843641 |
| Molecular Formula | C13H17BrFNO2S |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 2-(2-bromo-5-fluorophenyl)-1-(1,1-dioxothian-2-yl)ethanamine |
| SMILES | NC(Cc1cc(F)ccc1Br)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C13H17BrFNO2S/c14-11-5-4-10(15)7-9(11)8-12(16)13-3-1-2-6-19(13,17)18/h4-5,7,12-13H,1-3,6,8,16H2 |
| InChIKey | SCJZEOAYIATMNT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |