C13H16BrFO3S — CID 115822685
2-(3-bromo-5-fluorophenyl)-1-(1,1-dioxothian-2-yl)ethanol (PubChem CID 115822685) has the molecular formula C13H16BrFO3S and a molecular weight of 351.24 g/mol. Its IUPAC name is 2-(3-bromo-5-fluorophenyl)-1-(1,1-dioxothian-2-yl)ethanol.
| Compound Name | 2-(3-bromo-5-fluorophenyl)-1-(1,1-dioxothian-2-yl)ethanol |
|---|---|
| PubChem CID | 115822685 |
| Molecular Formula | C13H16BrFO3S |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 2-(3-bromo-5-fluorophenyl)-1-(1,1-dioxothian-2-yl)ethanol |
| SMILES | O=S1(=O)CCCCC1C(O)Cc1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C13H16BrFO3S/c14-10-5-9(6-11(15)8-10)7-12(16)13-3-1-2-4-19(13,17)18/h5-6,8,12-13,16H,1-4,7H2 |
| InChIKey | YCLKLVHHBPIHGY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |