C13H16F2O3S — CID 104522099
2-(2,6-difluorophenyl)-1-(1,1-dioxothian-2-yl)ethanol (PubChem CID 104522099) has the molecular formula C13H16F2O3S and a molecular weight of 290.33 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-1-(1,1-dioxothian-2-yl)ethanol.
| Compound Name | 2-(2,6-difluorophenyl)-1-(1,1-dioxothian-2-yl)ethanol |
|---|---|
| PubChem CID | 104522099 |
| Molecular Formula | C13H16F2O3S |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 2-(2,6-difluorophenyl)-1-(1,1-dioxothian-2-yl)ethanol |
| SMILES | O=S1(=O)CCCCC1C(O)Cc1c(F)cccc1F |
| InChI | InChI=1S/C13H16F2O3S/c14-10-4-3-5-11(15)9(10)8-12(16)13-6-1-2-7-19(13,17)18/h3-5,12-13,16H,1-2,6-8H2 |
| InChIKey | MXAIPFDRKREBLA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |