C13H16F2OS2 — CID 114931629
2-(2,6-difluorophenyl)-1-(3-methyl-1,4-dithian-2-yl)ethanol (PubChem CID 114931629) has the molecular formula C13H16F2OS2 and a molecular weight of 290.40 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-1-(3-methyl-1,4-dithian-2-yl)ethanol.
| Compound Name | 2-(2,6-difluorophenyl)-1-(3-methyl-1,4-dithian-2-yl)ethanol |
|---|---|
| PubChem CID | 114931629 |
| Molecular Formula | C13H16F2OS2 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 2-(2,6-difluorophenyl)-1-(3-methyl-1,4-dithian-2-yl)ethanol |
| SMILES | CC1SCCSC1C(O)Cc1c(F)cccc1F |
| InChI | InChI=1S/C13H16F2OS2/c1-8-13(18-6-5-17-8)12(16)7-9-10(14)3-2-4-11(9)15/h2-4,8,12-13,16H,5-7H2,1H3 |
| InChIKey | RXBMXTIJTKYYKT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |