C12H15F2NO2S — CID 115859778
(2,6-difluorophenyl)-(1,1-dioxothian-2-yl)methanamine (PubChem CID 115859778) has the molecular formula C12H15F2NO2S and a molecular weight of 275.32 g/mol. Its IUPAC name is (2,6-difluorophenyl)-(1,1-dioxothian-2-yl)methanamine.
| Compound Name | (2,6-difluorophenyl)-(1,1-dioxothian-2-yl)methanamine |
|---|---|
| PubChem CID | 115859778 |
| Molecular Formula | C12H15F2NO2S |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | (2,6-difluorophenyl)-(1,1-dioxothian-2-yl)methanamine |
| SMILES | NC(c1c(F)cccc1F)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C12H15F2NO2S/c13-8-4-3-5-9(14)11(8)12(15)10-6-1-2-7-18(10,16)17/h3-5,10,12H,1-2,6-7,15H2 |
| InChIKey | GHQPFMOOVLSHCD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |