C13H18BrNO3S — CID 104518399
(5-bromo-2-methoxyphenyl)-(1,1-dioxothian-2-yl)methanamine (PubChem CID 104518399) has the molecular formula C13H18BrNO3S and a molecular weight of 348.26 g/mol. Its IUPAC name is (5-bromo-2-methoxyphenyl)-(1,1-dioxothian-2-yl)methanamine.
| Compound Name | (5-bromo-2-methoxyphenyl)-(1,1-dioxothian-2-yl)methanamine |
|---|---|
| PubChem CID | 104518399 |
| Molecular Formula | C13H18BrNO3S |
| Molecular Weight | 348.26 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | (5-bromo-2-methoxyphenyl)-(1,1-dioxothian-2-yl)methanamine |
| SMILES | COc1ccc(Br)cc1C(N)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C13H18BrNO3S/c1-18-11-6-5-9(14)8-10(11)13(15)12-4-2-3-7-19(12,16)17/h5-6,8,12-13H,2-4,7,15H2,1H3 |
| InChIKey | HDHDPNFYPFHMQD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |