C15H23NO4S — CID 104518749
(4,5-dimethoxy-2-methylphenyl)-(1,1-dioxothian-2-yl)methanamine (PubChem CID 104518749) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is (4,5-dimethoxy-2-methylphenyl)-(1,1-dioxothian-2-yl)methanamine.
| Compound Name | (4,5-dimethoxy-2-methylphenyl)-(1,1-dioxothian-2-yl)methanamine |
|---|---|
| PubChem CID | 104518749 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (4,5-dimethoxy-2-methylphenyl)-(1,1-dioxothian-2-yl)methanamine |
| SMILES | COc1cc(C)c(C(N)C2CCCCS2(=O)=O)cc1OC |
| InChI | InChI=1S/C15H23NO4S/c1-10-8-12(19-2)13(20-3)9-11(10)15(16)14-6-4-5-7-21(14,17)18/h8-9,14-15H,4-7,16H2,1-3H3 |
| InChIKey | HJSJVXIGYOPYMI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |