C14H18Cl2O2S — CID 104521707
2-[chloro-(2-chloro-4,5-dimethylphenyl)methyl]thiane 1,1-dioxide (PubChem CID 104521707) has the molecular formula C14H18Cl2O2S and a molecular weight of 321.27 g/mol. Its IUPAC name is 2-[chloro-(2-chloro-4,5-dimethylphenyl)methyl]thiane 1,1-dioxide.
| Compound Name | 2-[chloro-(2-chloro-4,5-dimethylphenyl)methyl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 104521707 |
| Molecular Formula | C14H18Cl2O2S |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 2-[chloro-(2-chloro-4,5-dimethylphenyl)methyl]thiane 1,1-dioxide |
| SMILES | Cc1cc(Cl)c(C(Cl)C2CCCCS2(=O)=O)cc1C |
| InChI | InChI=1S/C14H18Cl2O2S/c1-9-7-11(12(15)8-10(9)2)14(16)13-5-3-4-6-19(13,17)18/h7-8,13-14H,3-6H2,1-2H3 |
| InChIKey | SREJKPHLIHWUPE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|