C10H13ClO2S2 — CID 164655231
2-[chloro-(5-methylthiophen-2-yl)methyl]thiolane 1,1-dioxide (PubChem CID 164655231) has the molecular formula C10H13ClO2S2 and a molecular weight of 264.80 g/mol. Its IUPAC name is 2-[chloro-(5-methylthiophen-2-yl)methyl]thiolane 1,1-dioxide.
| Compound Name | 2-[chloro-(5-methylthiophen-2-yl)methyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 164655231 |
| Molecular Formula | C10H13ClO2S2 |
| Molecular Weight | 264.80 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | 2-[chloro-(5-methylthiophen-2-yl)methyl]thiolane 1,1-dioxide |
| SMILES | Cc1ccc(C(Cl)C2CCCS2(=O)=O)s1 |
| InChI | InChI=1S/C10H13ClO2S2/c1-7-4-5-8(14-7)10(11)9-3-2-6-15(9,12)13/h4-5,9-10H,2-3,6H2,1H3 |
| InChIKey | XQRNTJIWINTRST-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.80 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|