C14H22N2O4S — CID 105305124
[(2,5-dimethoxyphenyl)-(1,1-dioxothian-2-yl)methyl]hydrazine (PubChem CID 105305124) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is [(2,5-dimethoxyphenyl)-(1,1-dioxothian-2-yl)methyl]hydrazine.
| Compound Name | [(2,5-dimethoxyphenyl)-(1,1-dioxothian-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105305124 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | [(2,5-dimethoxyphenyl)-(1,1-dioxothian-2-yl)methyl]hydrazine |
| SMILES | COc1ccc(OC)c(C(NN)C2CCCCS2(=O)=O)c1 |
| InChI | InChI=1S/C14H22N2O4S/c1-19-10-6-7-12(20-2)11(9-10)14(16-15)13-5-3-4-8-21(13,17)18/h6-7,9,13-14,16H,3-5,8,15H2,1-2H3 |
| InChIKey | NKTNLRPUQKQLRS-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|