C15H21NO3S — CID 105049108
3,4-dihydro-2H-chromen-8-yl-(1,1-dioxothian-2-yl)methanamine (PubChem CID 105049108) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-8-yl-(1,1-dioxothian-2-yl)methanamine.
| Compound Name | 3,4-dihydro-2H-chromen-8-yl-(1,1-dioxothian-2-yl)methanamine |
|---|---|
| PubChem CID | 105049108 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 3,4-dihydro-2H-chromen-8-yl-(1,1-dioxothian-2-yl)methanamine |
| SMILES | NC(c1cccc2c1OCCC2)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C15H21NO3S/c16-14(13-8-1-2-10-20(13,17)18)12-7-3-5-11-6-4-9-19-15(11)12/h3,5,7,13-14H,1-2,4,6,8-10,16H2 |
| InChIKey | PGDYQPRDSBUXCG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |