C15H22N2O2 — CID 114745734
3,4-dihydro-2H-chromen-8-yl-(4-methylmorpholin-2-yl)methanamine (PubChem CID 114745734) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-8-yl-(4-methylmorpholin-2-yl)methanamine.
| Compound Name | 3,4-dihydro-2H-chromen-8-yl-(4-methylmorpholin-2-yl)methanamine |
|---|---|
| PubChem CID | 114745734 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 3,4-dihydro-2H-chromen-8-yl-(4-methylmorpholin-2-yl)methanamine |
| SMILES | CN1CCOC(C(N)c2cccc3c2OCCC3)C1 |
| InChI | InChI=1S/C15H22N2O2/c1-17-7-9-18-13(10-17)14(16)12-6-2-4-11-5-3-8-19-15(11)12/h2,4,6,13-14H,3,5,7-10,16H2,1H3 |
| InChIKey | RQVQQGLYXSMOPK-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |