C14H20FNO2S — CID 106883860
(1,1-dioxothian-2-yl)-(2-fluoro-4,6-dimethylphenyl)methanamine (PubChem CID 106883860) has the molecular formula C14H20FNO2S and a molecular weight of 285.38 g/mol. Its IUPAC name is (1,1-dioxothian-2-yl)-(2-fluoro-4,6-dimethylphenyl)methanamine.
| Compound Name | (1,1-dioxothian-2-yl)-(2-fluoro-4,6-dimethylphenyl)methanamine |
|---|---|
| PubChem CID | 106883860 |
| Molecular Formula | C14H20FNO2S |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | (1,1-dioxothian-2-yl)-(2-fluoro-4,6-dimethylphenyl)methanamine |
| SMILES | Cc1cc(C)c(C(N)C2CCCCS2(=O)=O)c(F)c1 |
| InChI | InChI=1S/C14H20FNO2S/c1-9-7-10(2)13(11(15)8-9)14(16)12-5-3-4-6-19(12,17)18/h7-8,12,14H,3-6,16H2,1-2H3 |
| InChIKey | KAOGMWKQHNELSQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |