C13H16BrFO3S — CID 79711236
3-(3-bromo-5-fluorophenyl)-2-(1,1-dioxothiolan-3-yl)propan-1-ol (PubChem CID 79711236) has the molecular formula C13H16BrFO3S and a molecular weight of 351.24 g/mol. Its IUPAC name is 3-(3-bromo-5-fluorophenyl)-2-(1,1-dioxothiolan-3-yl)propan-1-ol.
| Compound Name | 3-(3-bromo-5-fluorophenyl)-2-(1,1-dioxothiolan-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 79711236 |
| Molecular Formula | C13H16BrFO3S |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 3-(3-bromo-5-fluorophenyl)-2-(1,1-dioxothiolan-3-yl)propan-1-ol |
| SMILES | O=S1(=O)CCC(C(CO)Cc2cc(F)cc(Br)c2)C1 |
| InChI | InChI=1S/C13H16BrFO3S/c14-12-4-9(5-13(15)6-12)3-11(7-16)10-1-2-19(17,18)8-10/h4-6,10-11,16H,1-3,7-8H2 |
| InChIKey | ZPASYMZWIBFFGX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |