C13H16BrClO2S — CID 64906026
3-[bromo-(4-chloro-2,5-dimethylphenyl)methyl]thiolane 1,1-dioxide (PubChem CID 64906026) has the molecular formula C13H16BrClO2S and a molecular weight of 351.69 g/mol. Its IUPAC name is 3-[bromo-(4-chloro-2,5-dimethylphenyl)methyl]thiolane 1,1-dioxide.
| Compound Name | 3-[bromo-(4-chloro-2,5-dimethylphenyl)methyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 64906026 |
| Molecular Formula | C13H16BrClO2S |
| Molecular Weight | 351.69 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | 3-[bromo-(4-chloro-2,5-dimethylphenyl)methyl]thiolane 1,1-dioxide |
| SMILES | Cc1cc(C(Br)C2CCS(=O)(=O)C2)c(C)cc1Cl |
| InChI | InChI=1S/C13H16BrClO2S/c1-8-6-12(15)9(2)5-11(8)13(14)10-3-4-18(16,17)7-10/h5-6,10,13H,3-4,7H2,1-2H3 |
| InChIKey | ZWAOHBUENWZTHY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.69 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|