C15H21BrO2S — CID 64905612
3-[bromo-(2,5-diethylphenyl)methyl]thiolane 1,1-dioxide (PubChem CID 64905612) has the molecular formula C15H21BrO2S and a molecular weight of 345.30 g/mol. Its IUPAC name is 3-[bromo-(2,5-diethylphenyl)methyl]thiolane 1,1-dioxide.
| Compound Name | 3-[bromo-(2,5-diethylphenyl)methyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 64905612 |
| Molecular Formula | C15H21BrO2S |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 3-[bromo-(2,5-diethylphenyl)methyl]thiolane 1,1-dioxide |
| SMILES | CCc1ccc(CC)c(C(Br)C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C15H21BrO2S/c1-3-11-5-6-12(4-2)14(9-11)15(16)13-7-8-19(17,18)10-13/h5-6,9,13,15H,3-4,7-8,10H2,1-2H3 |
| InChIKey | ITDXZVFAZHTZCM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|