C15H21BrO4S — CID 64904795
3-[bromo-(3,4-diethoxyphenyl)methyl]thiolane 1,1-dioxide (PubChem CID 64904795) has the molecular formula C15H21BrO4S and a molecular weight of 377.30 g/mol. Its IUPAC name is 3-[bromo-(3,4-diethoxyphenyl)methyl]thiolane 1,1-dioxide.
| Compound Name | 3-[bromo-(3,4-diethoxyphenyl)methyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 64904795 |
| Molecular Formula | C15H21BrO4S |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 3-[bromo-(3,4-diethoxyphenyl)methyl]thiolane 1,1-dioxide |
| SMILES | CCOc1ccc(C(Br)C2CCS(=O)(=O)C2)cc1OCC |
| InChI | InChI=1S/C15H21BrO4S/c1-3-19-13-6-5-11(9-14(13)20-4-2)15(16)12-7-8-21(17,18)10-12/h5-6,9,12,15H,3-4,7-8,10H2,1-2H3 |
| InChIKey | QHZPNIKEOZBCPL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|