C16H23Br — CID 83149719
2-(1-bromo-2-cyclopropylpropyl)-1,4-diethylbenzene (PubChem CID 83149719) has the molecular formula C16H23Br and a molecular weight of 295.26 g/mol. Its IUPAC name is 2-(1-bromo-2-cyclopropylpropyl)-1,4-diethylbenzene.
| Compound Name | 2-(1-bromo-2-cyclopropylpropyl)-1,4-diethylbenzene |
|---|---|
| PubChem CID | 83149719 |
| Molecular Formula | C16H23Br |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-(1-bromo-2-cyclopropylpropyl)-1,4-diethylbenzene |
| SMILES | CCc1ccc(CC)c(C(Br)C(C)C2CC2)c1 |
| InChI | InChI=1S/C16H23Br/c1-4-12-6-7-13(5-2)15(10-12)16(17)11(3)14-8-9-14/h6-7,10-11,14,16H,4-5,8-9H2,1-3H3 |
| InChIKey | QXWCWOMKMKGFKO-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|