C13H17BF3 — CID 145483057
CID 145483057 (PubChem CID 145483057) has the molecular formula C13H17BF3 and a molecular weight of 241.08 g/mol.
| Compound Name | CID 145483057 |
|---|---|
| PubChem CID | 145483057 |
| Molecular Formula | C13H17BF3 |
| Molecular Weight | 241.08 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | — |
| SMILES | CC[B]c1cc(C(C)CC)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H17BF3/c1-4-9(3)10-6-11(13(15,16)17)8-12(7-10)14-5-2/h6-9H,4-5H2,1-3H3 |
| InChIKey | WOCHFPPWKCKZGQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.08 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|