C12H6F12O — CID 139965753
1-[2,3,4,5-tetrakis(trifluoromethyl)phenyl]ethanol (PubChem CID 139965753) has the molecular formula C12H6F12O and a molecular weight of 394.16 g/mol. Its IUPAC name is 1-[2,3,4,5-tetrakis(trifluoromethyl)phenyl]ethanol.
| Compound Name | 1-[2,3,4,5-tetrakis(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 139965753 |
| Molecular Formula | C12H6F12O |
| Molecular Weight | 394.16 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | 1-[2,3,4,5-tetrakis(trifluoromethyl)phenyl]ethanol |
| SMILES | CC(O)c1cc(C(F)(F)F)c(C(F)(F)F)c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C12H6F12O/c1-3(25)4-2-5(9(13,14)15)7(11(19,20)21)8(12(22,23)24)6(4)10(16,17)18/h2-3,25H,1H3 |
| InChIKey | HMSADOLSXSCNJP-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.16 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |