C18H14F16O — CID 162347393
1,1,1,4,4,5,5,6,6,7,7,8,8,9,9,9-hexadecafluoro-2-(3-propan-2-ylphenyl)nonan-2-ol (PubChem CID 162347393) has the molecular formula C18H14F16O and a molecular weight of 550.28 g/mol. Its IUPAC name is 1,1,1,4,4,5,5,6,6,7,7,8,8,9,9,9-hexadecafluoro-2-(3-propan-2-ylphenyl)nonan-2-ol.
| Compound Name | 1,1,1,4,4,5,5,6,6,7,7,8,8,9,9,9-hexadecafluoro-2-(3-propan-2-ylphenyl)nonan-2-ol |
|---|---|
| PubChem CID | 162347393 |
| Molecular Formula | C18H14F16O |
| Molecular Weight | 550.28 g/mol |
| Exact Mass | 550.08 |
| IUPAC Name | 1,1,1,4,4,5,5,6,6,7,7,8,8,9,9,9-hexadecafluoro-2-(3-propan-2-ylphenyl)nonan-2-ol |
| SMILES | CC(C)c1cccc(C(O)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C18H14F16O/c1-8(2)9-4-3-5-10(6-9)11(35,17(29,30)31)7-12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)18(32,33)34/h3-6,8,35H,7H2,1-2H3 |
| InChIKey | VROWPRIOYWSIBO-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.28 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|