C13H18F2O — CID 164919043
1,1-difluoro-2-methyl-1-(3-propan-2-ylphenyl)propan-2-ol (PubChem CID 164919043) has the molecular formula C13H18F2O and a molecular weight of 228.28 g/mol. Its IUPAC name is 1,1-difluoro-2-methyl-1-(3-propan-2-ylphenyl)propan-2-ol.
| Compound Name | 1,1-difluoro-2-methyl-1-(3-propan-2-ylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 164919043 |
| Molecular Formula | C13H18F2O |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 1,1-difluoro-2-methyl-1-(3-propan-2-ylphenyl)propan-2-ol |
| SMILES | CC(C)c1cccc(C(F)(F)C(C)(C)O)c1 |
| InChI | InChI=1S/C13H18F2O/c1-9(2)10-6-5-7-11(8-10)13(14,15)12(3,4)16/h5-9,16H,1-4H3 |
| InChIKey | IMLCQVDEVNWOQU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |