C12H16F3N — CID 66510224
(1S)-1-(3-tert-butylphenyl)-2,2,2-trifluoroethanamine (PubChem CID 66510224) has the molecular formula C12H16F3N and a molecular weight of 231.26 g/mol. Its IUPAC name is (1S)-1-(3-tert-butylphenyl)-2,2,2-trifluoroethanamine.
| Compound Name | (1S)-1-(3-tert-butylphenyl)-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 66510224 |
| Molecular Formula | C12H16F3N |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | (1S)-1-(3-tert-butylphenyl)-2,2,2-trifluoroethanamine |
| SMILES | CC(C)(C)c1cccc([C@H](N)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H16F3N/c1-11(2,3)9-6-4-5-8(7-9)10(16)12(13,14)15/h4-7,10H,16H2,1-3H3/t10-/m0/s1 |
| InChIKey | BJLNKHJGNNSERA-JTQLQIEISA-N |
| XLogP | 3.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |