C12H16F3NO2S — CID 115850671
2-methyl-2-methylsulfonyl-1-[3-(trifluoromethyl)phenyl]propan-1-amine (PubChem CID 115850671) has the molecular formula C12H16F3NO2S and a molecular weight of 295.33 g/mol. Its IUPAC name is 2-methyl-2-methylsulfonyl-1-[3-(trifluoromethyl)phenyl]propan-1-amine.
| Compound Name | 2-methyl-2-methylsulfonyl-1-[3-(trifluoromethyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 115850671 |
| Molecular Formula | C12H16F3NO2S |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-methyl-2-methylsulfonyl-1-[3-(trifluoromethyl)phenyl]propan-1-amine |
| SMILES | CC(C)(C(N)c1cccc(C(F)(F)F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C12H16F3NO2S/c1-11(2,19(3,17)18)10(16)8-5-4-6-9(7-8)12(13,14)15/h4-7,10H,16H2,1-3H3 |
| InChIKey | RWAQPELBSAPQCZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |