C13H18F3NO3S — CID 173006917
[3,3-dimethyl-2-[3-(trifluoromethyl)phenyl]butyl] sulfamate (PubChem CID 173006917) has the molecular formula C13H18F3NO3S and a molecular weight of 325.35 g/mol. Its IUPAC name is [3,3-dimethyl-2-[3-(trifluoromethyl)phenyl]butyl] sulfamate.
| Compound Name | [3,3-dimethyl-2-[3-(trifluoromethyl)phenyl]butyl] sulfamate |
|---|---|
| PubChem CID | 173006917 |
| Molecular Formula | C13H18F3NO3S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | [3,3-dimethyl-2-[3-(trifluoromethyl)phenyl]butyl] sulfamate |
| SMILES | CC(C)(C)C(COS(N)(=O)=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H18F3NO3S/c1-12(2,3)11(8-20-21(17,18)19)9-5-4-6-10(7-9)13(14,15)16/h4-7,11H,8H2,1-3H3,(H2,17,18,19) |
| InChIKey | UYUCXRLMILUCMF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |