C22H16ClF13O — CID 162347592
3-(3-chlorophenyl)-5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-2-phenyldecan-3-ol (PubChem CID 162347592) has the molecular formula C22H16ClF13O and a molecular weight of 578.80 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-2-phenyldecan-3-ol.
| Compound Name | 3-(3-chlorophenyl)-5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-2-phenyldecan-3-ol |
|---|---|
| PubChem CID | 162347592 |
| Molecular Formula | C22H16ClF13O |
| Molecular Weight | 578.80 g/mol |
| Exact Mass | 578.07 |
| IUPAC Name | 3-(3-chlorophenyl)-5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-2-phenyldecan-3-ol |
| SMILES | CC(c1ccccc1)C(O)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H16ClF13O/c1-12(13-6-3-2-4-7-13)16(37,14-8-5-9-15(23)10-14)11-17(24,25)18(26,27)19(28,29)20(30,31)21(32,33)22(34,35)36/h2-10,12,37H,11H2,1H3 |
| InChIKey | VXDLTZQYWKNNFP-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.80 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|