C12H11BrF6O2 — CID 102722919
1-[2-bromo-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethyl]-3-methoxybenzene (PubChem CID 102722919) has the molecular formula C12H11BrF6O2 and a molecular weight of 381.11 g/mol. Its IUPAC name is 1-[2-bromo-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethyl]-3-methoxybenzene.
| Compound Name | 1-[2-bromo-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethyl]-3-methoxybenzene |
|---|---|
| PubChem CID | 102722919 |
| Molecular Formula | C12H11BrF6O2 |
| Molecular Weight | 381.11 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | 1-[2-bromo-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethyl]-3-methoxybenzene |
| SMILES | COc1cccc(C(CBr)OC(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11BrF6O2/c1-20-8-4-2-3-7(5-8)9(6-13)21-10(11(14,15)16)12(17,18)19/h2-5,9-10H,6H2,1H3 |
| InChIKey | DFEWKEAMITWFQC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.11 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|