C10H8F3NO — CID 79560176
3,3,3-trifluoro-2-(3-methoxyphenyl)propanenitrile (PubChem CID 79560176) has the molecular formula C10H8F3NO and a molecular weight of 215.17 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(3-methoxyphenyl)propanenitrile.
| Compound Name | 3,3,3-trifluoro-2-(3-methoxyphenyl)propanenitrile |
|---|---|
| PubChem CID | 79560176 |
| Molecular Formula | C10H8F3NO |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 3,3,3-trifluoro-2-(3-methoxyphenyl)propanenitrile |
| SMILES | COc1cccc(C(C#N)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H8F3NO/c1-15-8-4-2-3-7(5-8)9(6-14)10(11,12)13/h2-5,9H,1H3 |
| InChIKey | MJHJHJZUZPZYMZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |