C11H14F3NO2 — CID 65189932
4-amino-1,1,1-trifluoro-3-(3-methoxyphenyl)butan-2-ol (PubChem CID 65189932) has the molecular formula C11H14F3NO2 and a molecular weight of 249.23 g/mol. Its IUPAC name is 4-amino-1,1,1-trifluoro-3-(3-methoxyphenyl)butan-2-ol.
| Compound Name | 4-amino-1,1,1-trifluoro-3-(3-methoxyphenyl)butan-2-ol |
|---|---|
| PubChem CID | 65189932 |
| Molecular Formula | C11H14F3NO2 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 4-amino-1,1,1-trifluoro-3-(3-methoxyphenyl)butan-2-ol |
| SMILES | COc1cccc(C(CN)C(O)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H14F3NO2/c1-17-8-4-2-3-7(5-8)9(6-15)10(16)11(12,13)14/h2-5,9-10,16H,6,15H2,1H3 |
| InChIKey | FMMLWDLXOXHVOD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |