C9H16Cl2N2O — CID 138109115
1-(3-methoxyphenyl)ethane-1,2-diamine;dihydrochloride (PubChem CID 138109115) has the molecular formula C9H16Cl2N2O and a molecular weight of 239.15 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)ethane-1,2-diamine;dihydrochloride.
| Compound Name | 1-(3-methoxyphenyl)ethane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 138109115 |
| Molecular Formula | C9H16Cl2N2O |
| Molecular Weight | 239.15 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 1-(3-methoxyphenyl)ethane-1,2-diamine;dihydrochloride |
| SMILES | COc1cccc(C(N)CN)c1.Cl.Cl |
| InChI | InChI=1S/C9H14N2O.2ClH/c1-12-8-4-2-3-7(5-8)9(11)6-10;;/h2-5,9H,6,10-11H2,1H3;2*1H |
| InChIKey | DVGZBJGMTLDKFN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.15 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |