C14H19BrO2 — CID 62113881
1-(2-bromo-1-cyclopentyloxyethyl)-3-methoxybenzene (PubChem CID 62113881) has the molecular formula C14H19BrO2 and a molecular weight of 299.21 g/mol. Its IUPAC name is 1-(2-bromo-1-cyclopentyloxyethyl)-3-methoxybenzene.
| Compound Name | 1-(2-bromo-1-cyclopentyloxyethyl)-3-methoxybenzene |
|---|---|
| PubChem CID | 62113881 |
| Molecular Formula | C14H19BrO2 |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 1-(2-bromo-1-cyclopentyloxyethyl)-3-methoxybenzene |
| SMILES | COc1cccc(C(CBr)OC2CCCC2)c1 |
| InChI | InChI=1S/C14H19BrO2/c1-16-13-8-4-5-11(9-13)14(10-15)17-12-6-2-3-7-12/h4-5,8-9,12,14H,2-3,6-7,10H2,1H3 |
| InChIKey | OSFZSOKHXQONLT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|