C17H25IO2 — CID 114772754
1-[1-(2-ethylcyclohexyl)oxy-2-iodoethyl]-3-methoxybenzene (PubChem CID 114772754) has the molecular formula C17H25IO2 and a molecular weight of 388.29 g/mol. Its IUPAC name is 1-[1-(2-ethylcyclohexyl)oxy-2-iodoethyl]-3-methoxybenzene.
| Compound Name | 1-[1-(2-ethylcyclohexyl)oxy-2-iodoethyl]-3-methoxybenzene |
|---|---|
| PubChem CID | 114772754 |
| Molecular Formula | C17H25IO2 |
| Molecular Weight | 388.29 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 1-[1-(2-ethylcyclohexyl)oxy-2-iodoethyl]-3-methoxybenzene |
| SMILES | CCC1CCCCC1OC(CI)c1cccc(OC)c1 |
| InChI | InChI=1S/C17H25IO2/c1-3-13-7-4-5-10-16(13)20-17(12-18)14-8-6-9-15(11-14)19-2/h6,8-9,11,13,16-17H,3-5,7,10,12H2,1-2H3 |
| InChIKey | YUBMLSDDCVWOGM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.29 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|