C16H22Br2O — CID 55192868
1-bromo-3-[2-bromo-1-(2-ethylcyclohexyl)oxyethyl]benzene (PubChem CID 55192868) has the molecular formula C16H22Br2O and a molecular weight of 390.16 g/mol. Its IUPAC name is 1-bromo-3-[2-bromo-1-(2-ethylcyclohexyl)oxyethyl]benzene.
| Compound Name | 1-bromo-3-[2-bromo-1-(2-ethylcyclohexyl)oxyethyl]benzene |
|---|---|
| PubChem CID | 55192868 |
| Molecular Formula | C16H22Br2O |
| Molecular Weight | 390.16 g/mol |
| Exact Mass | 388.00 |
| IUPAC Name | 1-bromo-3-[2-bromo-1-(2-ethylcyclohexyl)oxyethyl]benzene |
| SMILES | CCC1CCCCC1OC(CBr)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H22Br2O/c1-2-12-6-3-4-9-15(12)19-16(11-17)13-7-5-8-14(18)10-13/h5,7-8,10,12,15-16H,2-4,6,9,11H2,1H3 |
| InChIKey | QWHIXFYMWCUNKU-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.16 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|