C22H19F3 — CID 139124399
1-phenyl-4-[(2S)-1,1,1-trifluoro-4-phenylbutan-2-yl]benzene (PubChem CID 139124399) has the molecular formula C22H19F3 and a molecular weight of 340.39 g/mol. Its IUPAC name is 1-phenyl-4-[(2S)-1,1,1-trifluoro-4-phenylbutan-2-yl]benzene.
| Compound Name | 1-phenyl-4-[(2S)-1,1,1-trifluoro-4-phenylbutan-2-yl]benzene |
|---|---|
| PubChem CID | 139124399 |
| Molecular Formula | C22H19F3 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 1-phenyl-4-[(2S)-1,1,1-trifluoro-4-phenylbutan-2-yl]benzene |
| SMILES | FC(F)(F)[C@@H](CCc1ccccc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H19F3/c23-22(24,25)21(16-11-17-7-3-1-4-8-17)20-14-12-19(13-15-20)18-9-5-2-6-10-18/h1-10,12-15,21H,11,16H2/t21-/m0/s1 |
| InChIKey | MMAKPADSHVFNOV-NRFANRHFSA-N |
| XLogP | 6.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |