C15H15BF3- — CID 102300911
[(1R)-1,3-diphenylpropyl]-trifluoroboranuide (PubChem CID 102300911) has the molecular formula C15H15BF3- and a molecular weight of 263.09 g/mol. Its IUPAC name is [(1R)-1,3-diphenylpropyl]-trifluoroboranuide.
| Compound Name | [(1R)-1,3-diphenylpropyl]-trifluoroboranuide |
|---|---|
| PubChem CID | 102300911 |
| Molecular Formula | C15H15BF3- |
| Molecular Weight | 263.09 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | [(1R)-1,3-diphenylpropyl]-trifluoroboranuide |
| SMILES | F[B-](F)(F)[C@H](CCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H15BF3/c17-16(18,19)15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-10,15H,11-12H2/q-1/t15-/m1/s1 |
| InChIKey | MIELFPVJPAREFT-OAHLLOKOSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.09 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|