C15H12F5NO — CID 171311776
(1S)-2,2,3,3,3-pentafluoro-1-(4-phenoxyphenyl)propan-1-amine (PubChem CID 171311776) has the molecular formula C15H12F5NO and a molecular weight of 317.26 g/mol. Its IUPAC name is (1S)-2,2,3,3,3-pentafluoro-1-(4-phenoxyphenyl)propan-1-amine.
| Compound Name | (1S)-2,2,3,3,3-pentafluoro-1-(4-phenoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 171311776 |
| Molecular Formula | C15H12F5NO |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | (1S)-2,2,3,3,3-pentafluoro-1-(4-phenoxyphenyl)propan-1-amine |
| SMILES | N[C@@H](c1ccc(Oc2ccccc2)cc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H12F5NO/c16-14(17,15(18,19)20)13(21)10-6-8-12(9-7-10)22-11-4-2-1-3-5-11/h1-9,13H,21H2/t13-/m0/s1 |
| InChIKey | QGCJEFNGYXLHBL-ZDUSSCGKSA-N |
| XLogP | 4.68 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|