C15H19N2O4P — CID 102389288
[(1R,2S)-1,2-diamino-1-(4-phenoxyphenyl)propan-2-yl]phosphonic acid (PubChem CID 102389288) has the molecular formula C15H19N2O4P and a molecular weight of 322.30 g/mol. Its IUPAC name is [(1R,2S)-1,2-diamino-1-(4-phenoxyphenyl)propan-2-yl]phosphonic acid.
| Compound Name | [(1R,2S)-1,2-diamino-1-(4-phenoxyphenyl)propan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 102389288 |
| Molecular Formula | C15H19N2O4P |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | [(1R,2S)-1,2-diamino-1-(4-phenoxyphenyl)propan-2-yl]phosphonic acid |
| SMILES | C[C@@](N)([C@H](N)c1ccc(Oc2ccccc2)cc1)P(=O)(O)O |
| InChI | InChI=1S/C15H19N2O4P/c1-15(17,22(18,19)20)14(16)11-7-9-13(10-8-11)21-12-5-3-2-4-6-12/h2-10,14H,16-17H2,1H3,(H2,18,19,20)/t14-,15+/m1/s1 |
| InChIKey | HGGHJURODSUBEZ-CABCVRRESA-N |
| XLogP | 2.33 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|