C13H22NO6P — CID 68614393
(1-amino-2-methyl-1-phenylpropan-2-yl)phosphonic acid;2-hydroxypropanoic acid (PubChem CID 68614393) has the molecular formula C13H22NO6P and a molecular weight of 319.29 g/mol. Its IUPAC name is (1-amino-2-methyl-1-phenylpropan-2-yl)phosphonic acid;2-hydroxypropanoic acid.
| Compound Name | (1-amino-2-methyl-1-phenylpropan-2-yl)phosphonic acid;2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 68614393 |
| Molecular Formula | C13H22NO6P |
| Molecular Weight | 319.29 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | (1-amino-2-methyl-1-phenylpropan-2-yl)phosphonic acid;2-hydroxypropanoic acid |
| SMILES | CC(C)(C(N)c1ccccc1)P(=O)(O)O.CC(O)C(=O)O |
| InChI | InChI=1S/C10H16NO3P.C3H6O3/c1-10(2,15(12,13)14)9(11)8-6-4-3-5-7-8;1-2(4)3(5)6/h3-7,9H,11H2,1-2H3,(H2,12,13,14);2,4H,1H3,(H,5,6) |
| InChIKey | KFGMAWVADRNKAU-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.29 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|