C15H18N2O — CID 116954329
N,N'-dimethyl-1-(4-phenoxyphenyl)methanediamine (PubChem CID 116954329) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is N,N'-dimethyl-1-(4-phenoxyphenyl)methanediamine.
| Compound Name | N,N'-dimethyl-1-(4-phenoxyphenyl)methanediamine |
|---|---|
| PubChem CID | 116954329 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | N,N'-dimethyl-1-(4-phenoxyphenyl)methanediamine |
| SMILES | CNC(NC)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C15H18N2O/c1-16-15(17-2)12-8-10-14(11-9-12)18-13-6-4-3-5-7-13/h3-11,15-17H,1-2H3 |
| InChIKey | JZIAHBZAGKFZFD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|