C16H20N2O — CID 116909235
N,N',N'-trimethyl-1-(4-phenoxyphenyl)methanediamine (PubChem CID 116909235) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is N,N',N'-trimethyl-1-(4-phenoxyphenyl)methanediamine.
| Compound Name | N,N',N'-trimethyl-1-(4-phenoxyphenyl)methanediamine |
|---|---|
| PubChem CID | 116909235 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | N,N',N'-trimethyl-1-(4-phenoxyphenyl)methanediamine |
| SMILES | CNC(c1ccc(Oc2ccccc2)cc1)N(C)C |
| InChI | InChI=1S/C16H20N2O/c1-17-16(18(2)3)13-9-11-15(12-10-13)19-14-7-5-4-6-8-14/h4-12,16-17H,1-3H3 |
| InChIKey | ZAHUVXRCEAADQW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|