C22H31NO — CID 145029276
buta-1,3-diene;N,N-dimethyl-1-(4-phenoxyphenyl)ethanamine;ethane (PubChem CID 145029276) has the molecular formula C22H31NO and a molecular weight of 325.50 g/mol. Its IUPAC name is buta-1,3-diene;N,N-dimethyl-1-(4-phenoxyphenyl)ethanamine;ethane.
| Compound Name | buta-1,3-diene;N,N-dimethyl-1-(4-phenoxyphenyl)ethanamine;ethane |
|---|---|
| PubChem CID | 145029276 |
| Molecular Formula | C22H31NO |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | buta-1,3-diene;N,N-dimethyl-1-(4-phenoxyphenyl)ethanamine;ethane |
| SMILES | C=CC=C.CC.CC(c1ccc(Oc2ccccc2)cc1)N(C)C |
| InChI | InChI=1S/C16H19NO.C4H6.C2H6/c1-13(17(2)3)14-9-11-16(12-10-14)18-15-7-5-4-6-8-15;1-3-4-2;1-2/h4-13H,1-3H3;3-4H,1-2H2;1-2H3 |
| InChIKey | PAKNURQGPRAMIA-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|