C21H27NO3 — CID 125457244
tert-butyl (3S)-3-amino-2,2-dimethyl-3-(4-phenoxyphenyl)propanoate (PubChem CID 125457244) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is tert-butyl (3S)-3-amino-2,2-dimethyl-3-(4-phenoxyphenyl)propanoate.
| Compound Name | tert-butyl (3S)-3-amino-2,2-dimethyl-3-(4-phenoxyphenyl)propanoate |
|---|---|
| PubChem CID | 125457244 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | tert-butyl (3S)-3-amino-2,2-dimethyl-3-(4-phenoxyphenyl)propanoate |
| SMILES | CC(C)(C)OC(=O)C(C)(C)[C@@H](N)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C21H27NO3/c1-20(2,3)25-19(23)21(4,5)18(22)15-11-13-17(14-12-15)24-16-9-7-6-8-10-16/h6-14,18H,22H2,1-5H3/t18-/m0/s1 |
| InChIKey | PPDCNABLZCPJDS-SFHVURJKSA-N |
| XLogP | 4.85 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |