C12H16F5NOSi — CID 171312443
(1R)-2,2,3,3,3-pentafluoro-1-(4-trimethylsilyloxyphenyl)propan-1-amine (PubChem CID 171312443) has the molecular formula C12H16F5NOSi and a molecular weight of 313.34 g/mol. Its IUPAC name is (1R)-2,2,3,3,3-pentafluoro-1-(4-trimethylsilyloxyphenyl)propan-1-amine.
| Compound Name | (1R)-2,2,3,3,3-pentafluoro-1-(4-trimethylsilyloxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 171312443 |
| Molecular Formula | C12H16F5NOSi |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (1R)-2,2,3,3,3-pentafluoro-1-(4-trimethylsilyloxyphenyl)propan-1-amine |
| SMILES | C[Si](C)(C)Oc1ccc([C@@H](N)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H16F5NOSi/c1-20(2,3)19-9-6-4-8(5-7-9)10(18)11(13,14)12(15,16)17/h4-7,10H,18H2,1-3H3/t10-/m1/s1 |
| InChIKey | ZWCDLPJGTQWCAW-SNVBAGLBSA-N |
| XLogP | 4.10 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|