C12H15ClF5NO — CID 171311850
(1S)-2,2,3,3,3-pentafluoro-1-(4-propan-2-yloxyphenyl)propan-1-amine;hydrochloride (PubChem CID 171311850) has the molecular formula C12H15ClF5NO and a molecular weight of 319.70 g/mol. Its IUPAC name is (1S)-2,2,3,3,3-pentafluoro-1-(4-propan-2-yloxyphenyl)propan-1-amine;hydrochloride.
| Compound Name | (1S)-2,2,3,3,3-pentafluoro-1-(4-propan-2-yloxyphenyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171311850 |
| Molecular Formula | C12H15ClF5NO |
| Molecular Weight | 319.70 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | (1S)-2,2,3,3,3-pentafluoro-1-(4-propan-2-yloxyphenyl)propan-1-amine;hydrochloride |
| SMILES | CC(C)Oc1ccc([C@H](N)C(F)(F)C(F)(F)F)cc1.Cl |
| InChI | InChI=1S/C12H14F5NO.ClH/c1-7(2)19-9-5-3-8(4-6-9)10(18)11(13,14)12(15,16)17;/h3-7,10H,18H2,1-2H3;1H/t10-;/m0./s1 |
| InChIKey | SMMMPDADLBVPTL-PPHPATTJSA-N |
| XLogP | 4.09 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.70 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|