C11H14ClFN2 — CID 171225183
(1S)-3-fluoro-1-(1H-indol-6-yl)propan-1-amine;hydrochloride (PubChem CID 171225183) has the molecular formula C11H14ClFN2 and a molecular weight of 228.70 g/mol. Its IUPAC name is (1S)-3-fluoro-1-(1H-indol-6-yl)propan-1-amine;hydrochloride.
| Compound Name | (1S)-3-fluoro-1-(1H-indol-6-yl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171225183 |
| Molecular Formula | C11H14ClFN2 |
| Molecular Weight | 228.70 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | (1S)-3-fluoro-1-(1H-indol-6-yl)propan-1-amine;hydrochloride |
| SMILES | Cl.N[C@@H](CCF)c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C11H13FN2.ClH/c12-5-3-10(13)9-2-1-8-4-6-14-11(8)7-9;/h1-2,4,6-7,10,14H,3,5,13H2;1H/t10-;/m0./s1 |
| InChIKey | ZNDMUBOJCSCZSY-PPHPATTJSA-N |
| XLogP | 2.95 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.70 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |