5-(3-cyano-1,2-dihydroxypropyl)naphthalene-1-carboxylic acid

C15H13NO4 — CID 171901935

IUPAC5-(3-cyano-1,2-dihydroxypropyl)naphthalene-1-carboxylic acid
SMILESN#CCC(O)C(O)c1cccc2c(C(=O)O)cccc12
InChIInChI=1S/C15H13NO4/c16-8-7-13(17)14(18)11-5-1-4-10-9(11)3-2-6-12(10)15(19)20/h1-6,13-14,17-18H,7H2,(H,19,20)
InChIKeyLRHAOFYEZBBKDK-UHFFFAOYSA-N
MW271.27 g/mol
LogP1.85
Rot. Bonds4

About 5-(3-cyano-1,2-dihydroxypropyl)naphthalene-1-carboxylic acid

5-(3-cyano-1,2-dihydroxypropyl)naphthalene-1-carboxylic acid (PubChem CID 171901935) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is 5-(3-cyano-1,2-dihydroxypropyl)naphthalene-1-carboxylic acid.

Molecular Properties

Compound Name5-(3-cyano-1,2-dihydroxypropyl)naphthalene-1-carboxylic acid
PubChem CID171901935
Molecular FormulaC15H13NO4
Molecular Weight271.27 g/mol
Exact Mass271.08
IUPAC Name5-(3-cyano-1,2-dihydroxypropyl)naphthalene-1-carboxylic acid
SMILESN#CCC(O)C(O)c1cccc2c(C(=O)O)cccc12
InChIInChI=1S/C15H13NO4/c16-8-7-13(17)14(18)11-5-1-4-10-9(11)3-2-6-12(10)15(19)20/h1-6,13-14,17-18H,7H2,(H,19,20)
InChIKeyLRHAOFYEZBBKDK-UHFFFAOYSA-N
XLogP1.85
TPSA101.55 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.27
LogP ≤ 51.85
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 5-(3-cyano-1,2-dihydroxypropyl)naphthalene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(3-cyano-1,2-dihydroxypropyl)naphthalene-1-carboxylic acid?
The IUPAC name of 5-(3-cyano-1,2-dihydroxypropyl)naphthalene-1-carboxylic acid (CID 171901935) is 5-(3-cyano-1,2-dihydroxypropyl)naphthalene-1-carboxylic acid.
What is the SMILES notation for 5-(3-cyano-1,2-dihydroxypropyl)naphthalene-1-carboxylic acid?
The canonical SMILES for 5-(3-cyano-1,2-dihydroxypropyl)naphthalene-1-carboxylic acid is N#CCC(O)C(O)c1cccc2c(C(=O)O)cccc12.
What is the InChIKey of 5-(3-cyano-1,2-dihydroxypropyl)naphthalene-1-carboxylic acid?
The InChIKey is LRHAOFYEZBBKDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO4/c16-8-7-13(17)14(18)11-5-1-4-10-9(11)3-2-6-12(10)15(19)20/h1-6,13-14,17-18H,7H2,(H,19,20).
What are the key properties of 5-(3-cyano-1,2-dihydroxypropyl)naphthalene-1-carboxylic acid?
5-(3-cyano-1,2-dihydroxypropyl)naphthalene-1-carboxylic acid has a molecular weight of 271.27 g/mol, XLogP of 1.85, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-cyano-1,2-dihydroxypropyl)naphthalene-1-carboxylic acid is sourced from PubChem (CID 171901935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).