C15H13NO4 — CID 171901935
5-(3-cyano-1,2-dihydroxypropyl)naphthalene-1-carboxylic acid (PubChem CID 171901935) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is 5-(3-cyano-1,2-dihydroxypropyl)naphthalene-1-carboxylic acid.
| Compound Name | 5-(3-cyano-1,2-dihydroxypropyl)naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 171901935 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 5-(3-cyano-1,2-dihydroxypropyl)naphthalene-1-carboxylic acid |
| SMILES | N#CCC(O)C(O)c1cccc2c(C(=O)O)cccc12 |
| InChI | InChI=1S/C15H13NO4/c16-8-7-13(17)14(18)11-5-1-4-10-9(11)3-2-6-12(10)15(19)20/h1-6,13-14,17-18H,7H2,(H,19,20) |
| InChIKey | LRHAOFYEZBBKDK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |