C10H10N2O4 — CID 171901054
5-(3-cyano-1,2-dihydroxypropyl)pyridine-3-carboxylic acid (PubChem CID 171901054) has the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. Its IUPAC name is 5-(3-cyano-1,2-dihydroxypropyl)pyridine-3-carboxylic acid.
| Compound Name | 5-(3-cyano-1,2-dihydroxypropyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 171901054 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 5-(3-cyano-1,2-dihydroxypropyl)pyridine-3-carboxylic acid |
| SMILES | N#CCC(O)C(O)c1cncc(C(=O)O)c1 |
| InChI | InChI=1S/C10H10N2O4/c11-2-1-8(13)9(14)6-3-7(10(15)16)5-12-4-6/h3-5,8-9,13-14H,1H2,(H,15,16) |
| InChIKey | KAGGUKMOYHCLAY-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |